ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-71-9 bis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate |
|
| Chemical Name | bis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate |
| Synonyms | Bis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.6038 |
| InChl | InChI=1/C24H44O4/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2/h19-22H,5-18H2,1-4H3 |
| CAS Registry Number | 84-71-9 |
| EINECS | 201-554-8 |
| Molecular Structure | ![]() |
| Density | 0.959g/cm3 |
| Boiling Point | 463.9°C at 760 mmHg |
| Refractive Index | 1.465 |
| Flash Point | 217.2°C |
| Vapour Pressur | 8.75E-09mmHg at 25°C |
| MSDS | |