ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-73-1 bis(2-hydroxyethyl) phthalate |
|
| Chemical Name | bis(2-hydroxyethyl) phthalate |
| Synonyms | Bis(2-hydroxyethyl) phthalate;Bis(beta-hydroxyethyl) phthalate;1,2-Benzenedicarboxylic acid, 1,2-bis(2-hydroxyethyl) ester;1,2-Benzenedicarboxylic acid, bis(2-hydroxyethyl) ester;bis(2-hydroxyethyl) benzene-1,2-dicarboxylate |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.236 |
| InChl | InChI=1/C12H14O6/c13-5-7-17-11(15)9-3-1-2-4-10(9)12(16)18-8-6-14/h1-4,13-14H,5-8H2 |
| CAS Registry Number | 84-73-1 |
| EINECS | 201-556-9 |
| Molecular Structure | ![]() |
| Density | 1.315g/cm3 |
| Boiling Point | 417.2°C at 760 mmHg |
| Refractive Index | 1.556 |
| Flash Point | 159.2°C |
| Vapour Pressur | 1.05E-07mmHg at 25°C |
| MSDS | |