ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-04-1 N-(2-methoxy-1-naphthyl)acetamide |
|
| Chemical Name | N-(2-methoxy-1-naphthyl)acetamide |
| Synonyms | Acetamide, N-(2-methoxy-1-naphthalenyl)-;N-(2-Methoxy-1-naphthyl)acetamide;NSC 112918;Acetamide, N-(2-methoxy-1-naphthyl)- (8CI);N-(2-methoxynaphthalen-1-yl)acetamide |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.2478 |
| InChl | InChI=1/C13H13NO2/c1-9(15)14-13-11-6-4-3-5-10(11)7-8-12(13)16-2/h3-8H,1-2H3,(H,14,15) |
| CAS Registry Number | 85-04-1 |
| EINECS | 201-583-6 |
| Molecular Structure | ![]() |
| Density | 1.191g/cm3 |
| Boiling Point | 409.1°C at 760 mmHg |
| Refractive Index | 1.639 |
| Flash Point | 201.2°C |
| Vapour Pressur | 6.69E-07mmHg at 25°C |
| MSDS | |