ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-10-9 N~4~-(7-chloro-3-methylquinolin-4-yl)-N~1~,N~1~-diethylpentane-1,4-diamine |
|
| Chemical Name | N~4~-(7-chloro-3-methylquinolin-4-yl)-N~1~,N~1~-diethylpentane-1,4-diamine |
| Synonyms | 1,4-pentanediamine, N~4~-(7-chloro-3-methyl-4-quinolinyl)-N~1~,N~1~-diethyl- |
| Molecular Formula | C19H28ClN3 |
| Molecular Weight | 333.8987 |
| InChl | InChI=1/C19H28ClN3/c1-5-23(6-2)11-7-8-15(4)22-19-14(3)13-21-18-12-16(20)9-10-17(18)19/h9-10,12-13,15H,5-8,11H2,1-4H3,(H,21,22) |
| CAS Registry Number | 85-10-9 |
| Molecular Structure | ![]() |
| Density | 1.097g/cm3 |
| Boiling Point | 473.8°C at 760 mmHg |
| Refractive Index | 1.587 |
| Flash Point | 240.3°C |
| Vapour Pressur | 3.81E-09mmHg at 25°C |
| MSDS | |