ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-16-5 2,4,6-triiodo-3,5-bis(propanoylamino)benzoic acid |
|
| Chemical Name | 2,4,6-triiodo-3,5-bis(propanoylamino)benzoic acid |
| Synonyms | 2,4,6-Triiodo-3,5-bis((1-oxopropyl)amino)benzoic Acid;85-16-5 |
| Molecular Formula | C13H13I3N2O4 |
| Molecular Weight | 641.9667 |
| InChl | InChI=1/C13H13I3N2O4/c1-3-5(19)17-11-8(14)7(13(21)22)9(15)12(10(11)16)18-6(20)4-2/h3-4H2,1-2H3,(H,17,19)(H,18,20)(H,21,22) |
| CAS Registry Number | 85-16-5 |
| Molecular Structure | ![]() |
| Density | 2.401g/cm3 |
| Boiling Point | 623.4°C at 760 mmHg |
| Refractive Index | 1.757 |
| Flash Point | 330.8°C |
| Vapour Pressur | 2.1E-16mmHg at 25°C |
| MSDS | |