ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-28-9 4'-chloro-2-hydroxy-4-methoxybenzophenone |
|
| Chemical Name | 4'-chloro-2-hydroxy-4-methoxybenzophenone |
| Molecular Formula | C14H11ClO3 |
| Molecular Weight | 262.6883 |
| InChl | InChI=1/C14H11ClO3/c1-18-11-6-7-12(13(16)8-11)14(17)9-2-4-10(15)5-3-9/h2-8,16H,1H3 |
| CAS Registry Number | 85-28-9 |
| EINECS | 201-595-1 |
| Molecular Structure | ![]() |
| Density | 1.3g/cm3 |
| Boiling Point | 405.2°C at 760 mmHg |
| Refractive Index | 1.604 |
| Flash Point | 198.9°C |
| Vapour Pressur | 3.81E-07mmHg at 25°C |
| MSDS | |