ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-33-6 lactaroviolin |
|
| Chemical Name | lactaroviolin |
| Synonyms | 7-isopropenyl-4-methylazulene-1-carbaldehyde;4-methyl-7-(prop-1-en-2-yl)azulene-1-carbaldehyde |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.2711 |
| InChl | InChI=1/C15H14O/c1-10(2)12-5-4-11(3)14-7-6-13(9-16)15(14)8-12/h4-9H,1H2,2-3H3 |
| CAS Registry Number | 85-33-6 |
| Molecular Structure | ![]() |
| Density | 1.065g/cm3 |
| Boiling Point | 363.7°C at 760 mmHg |
| Refractive Index | 1.626 |
| Flash Point | 200.2°C |
| Vapour Pressur | 1.77E-05mmHg at 25°C |
| MSDS | |