ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-65-4 1-(3,4-dimethoxybenzyl)-7-methoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-6-ol |
|
| Chemical Name | 1-(3,4-dimethoxybenzyl)-7-methoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-6-ol |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.4168 |
| InChl | InChI=1/C20H25NO4/c1-21-8-7-14-11-17(22)19(24-3)12-15(14)16(21)9-13-5-6-18(23-2)20(10-13)25-4/h5-6,10-12,16,22H,7-9H2,1-4H3 |
| CAS Registry Number | 85-65-4 |
| Molecular Structure | ![]() |
| Density | 1.159g/cm3 |
| Boiling Point | 483.4°C at 760 mmHg |
| Refractive Index | 1.574 |
| Flash Point | 246.1°C |
| Vapour Pressur | 5.75E-10mmHg at 25°C |
| MSDS | |