ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-49-7 2-chloro-N,N-diethyl-4-nitroaniline |
|
| Chemical Name | 2-chloro-N,N-diethyl-4-nitroaniline |
| Synonyms | Benzenamine, 2-chloro-N,N-diethyl-4-nitro-;2-Chloro-N,N-diethyl-4-nitroaniline |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.6754 |
| InChl | InChI=1/C10H13ClN2O2/c1-3-12(4-2)10-6-5-8(13(14)15)7-9(10)11/h5-7H,3-4H2,1-2H3 |
| CAS Registry Number | 86-49-7 |
| EINECS | 201-675-6 |
| Molecular Structure | ![]() |
| Density | 1.241g/cm3 |
| Boiling Point | 326.7°C at 760 mmHg |
| Refractive Index | 1.579 |
| Flash Point | 151.4°C |
| Vapour Pressur | 0.000212mmHg at 25°C |
| MSDS | |