ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-79-3 2-Hydroxycarbazole |
|
| Chemical Name | 2-Hydroxycarbazole |
| Synonyms | carbazol-2-ol;9H-carbazol-2-ol;2-Hydroxy-9H-carbazole |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.206 |
| InChl | InChI=1/C12H9NO/c14-8-5-6-10-9-3-1-2-4-11(9)13-12(10)7-8/h1-7,13-14H |
| CAS Registry Number | 86-79-3 |
| EINECS | 201-699-7 |
| Molecular Structure | ![]() |
| Density | 1.362g/cm3 |
| Melting Point | 273-275℃ |
| Boiling Point | 431.4°C at 760 mmHg |
| Refractive Index | 1.815 |
| Flash Point | 214.7°C |
| Vapour Pressur | 4.78E-08mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |