ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-84-0 α-Naphthyl isocyanate |
|
| Chemical Name | α-Naphthyl isocyanate |
| Synonyms | Alpha-naphthylcarbylamine;alpha-Naphthyl isocyanate;1-Naphthyl isocyanate;1-isocyanatonaphthalene |
| Molecular Formula | C11H7NO |
| Molecular Weight | 169.1794 |
| InChl | InChI=1/C11H7NO/c13-8-12-11-7-3-5-9-4-1-2-6-10(9)11/h1-7H |
| CAS Registry Number | 86-84-0 |
| EINECS | 201-703-7 |
| Molecular Structure | ![]() |
| Density | 1.09g/cm3 |
| Melting Point | 4℃ |
| Boiling Point | 270°C at 760 mmHg |
| Refractive Index | 1.588 |
| Flash Point | 98.2°C |
| Vapour Pressur | 0.00702mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R20/21/22||R36/37/38:; |
| Safety Description | S26||S36/37/39:; |
| MSDS | |