ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
96-96-8 4-methoxy-2-nitro-aniline |
|
| Chemical Name | 4-methoxy-2-nitro-aniline |
| Synonyms | C.I. 37135;C.I. Azoic Diazo Component 1;Benzenamine, 4-methoxy-2-nitro-;2-Nitro-p-anisidine;fast bordeaux gp salt;fast bordeaux GP base;4-Amino-3-nitroanisole;2-Nitro-4-methoxyaniline;2-nitro-p-anisidin;4-Amino-3-nitroanisol;4-Methoxy-2-mitrobenzenamine;4-methoxy-2-nitroanilin;4-methoxy-2-nitro-anilin;4-methoxy-2-nitro-benzenamin;Acco Fast Bordeaux GP Salt;Dark Red Developing Base 4RB;Bordeaux base GP;4-methoxy-2-nitroaniline;4-Methoxy-2-Nitro-Phenylamine;CLARETAZOIC BASE GP |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 |
| InChl | InChI=1/C7H8N2O3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,8H2,1H3 |
| CAS Registry Number | 96-96-8 |
| EINECS | 202-547-2 |
| Molecular Structure | ![]() |
| Density | 1.318g/cm3 |
| Melting Point | 123-126℃ |
| Boiling Point | 338.3°C at 760 mmHg |
| Refractive Index | 1.601 |
| Flash Point | 158.4°C |
| Water Solubility | slightly soluble |
| Vapour Pressur | 9.93E-05mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R26/27/28||R33||R52/53:; |
| Safety Description | S28||S36/37||S45||S61:; |
| MSDS | |