ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97-59-6 Allantoin |
|
| Chemical Name | Allantoin |
| Synonyms | Alantan;5-Ureidohydantoin;Allantion;(2,5-dioxo-4-imidazolidinyl)-urea;(2,5-Dioxo-4-Imidazo-Lidinyl)Urea ;1-(2,5-dioxoimidazolidin-4-yl)urea;1-[(4R)-2,5-dioxoimidazolidin-4-yl]urea;1-[(4S)-2,5-dioxoimidazolidin-4-yl]urea;Allegron;Alphosyl;Alyonyldiurened;Cordianine;Egopsoryl;Sebical;Allantoinum |
| Molecular Formula | C4H6N4O3 |
| Molecular Weight | 158.1154 |
| InChl | InChI=1/C4H6N4O3/c5-3(10)6-1-2(9)8-4(11)7-1/h1H,(H3,5,6,10)(H2,7,8,9,11)/t1-/m0/s1 |
| CAS Registry Number | 97-59-6 |
| EINECS | 202-592-8 |
| Molecular Structure | ![]() |
| Density | 1.65g/cm3 |
| Melting Point | 230℃ |
| Refractive Index | 1.615 |
| Safety Description | S24/25:; |
| MSDS | |