ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98-86-2 Acetophenone |
|
| Chemical Name | Acetophenone |
| Synonyms | Methyl phenyl ketone;1-Phenylethanone;alpha-Acetophenone;1-Phenyl-1-ethanone;phenyl methyl ketone |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 |
| InChl | InChI=1/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3 |
| CAS Registry Number | 98-86-2 |
| EINECS | 202-708-7 |
| Molecular Structure | ![]() |
| Density | 1.0266 |
| Melting Point | 19.6℃ |
| Boiling Point | 202℃ |
| Refractive Index | 1.5315-1.534 |
| Flash Point | 77℃ |
| Water Solubility | 5.5 g/L (20℃) |
| Hazard Symbols | |
| Risk Codes | R22||R36:; |
| Safety Description | S26:; |
| MSDS | |