ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-28-5 2,6-dibromo-4-nitrophenol |
|
| Chemical Name | 2,6-dibromo-4-nitrophenol |
| Synonyms | Phenol, 2,6-dibromo-4-nitro-;2,6-Dibromo-4-nitrophenol;4-06-00-01366 (Beilstein Handbook Reference);4-Nitro-2,6-dibromophenol;AI3-01539;BRN 1245050;NSC 2585;2,6-dibromo-4-nitrophenolate |
| Molecular Formula | C6H2Br2NO3 |
| Molecular Weight | 295.8935 |
| InChl | InChI=1/C6H3Br2NO3/c7-4-1-3(9(11)12)2-5(8)6(4)10/h1-2,10H/p-1 |
| CAS Registry Number | 99-28-5 |
| EINECS | 202-744-3 |
| Molecular Structure | ![]() |
| Melting Point | 145℃ (dec.) |
| Boiling Point | 297.8°C at 760 mmHg |
| Flash Point | 133.9°C |
| Vapour Pressur | 0.000744mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R20/21/22||R36/37/38:; |
| Safety Description | S26||S36:; |
| MSDS | |