ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-71-8 4-sec-butylphenol |
|
| Chemical Name | 4-sec-butylphenol |
| Synonyms | p-(1-Methylpropyl)phenol;N-Hydroxyethyl Benzamide;Para-sec-butylphenol;4-(butan-2-yl)phenol;4-(2-Butyl)Phenol |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.2176 |
| InChl | InChI=1/C10H14O/c1-3-8(2)9-4-6-10(11)7-5-9/h4-8,11H,3H2,1-2H3 |
| CAS Registry Number | 99-71-8 |
| EINECS | 202-781-5 |
| Molecular Structure | ![]() |
| Density | 0.972g/cm3 |
| Melting Point | 46-59℃ |
| Boiling Point | 241°C at 760 mmHg |
| Refractive Index | 1.52 |
| Flash Point | 107.4°C |
| Vapour Pressur | 0.0237mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R34:; |
| Safety Description | S26||S27||S28||S36/37/39||S45:; |
| MSDS | |