ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
125239-87-4 nitrate d’hydroxyle |
|
| Nom | nitrate d’hydroxyle |
| Nom anglais | hydroxy nitrate; |
| Formule moléculaire | HNO4 |
| Poids Moléculaire | 79.0122 |
| InChl | InChI=1/HNO4/c2-1(3)5-4/h4H |
| Numéro de registre CAS | 125239-87-4;26404-66-0 |
| Structure moléculaire | ![]() |
| Densité | 1.748g/cm3 |
| Indice de réfraction | 1.416 |
| MSDS | |