ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
127926-10-7 (1R,2S)-7-méthyl-1,2-dihydronaphtalène-1,2-diol |
|
| Nom | (1R,2S)-7-méthyl-1,2-dihydronaphtalène-1,2-diol |
| Nom anglais | (1R,2S)-7-methyl-1,2-dihydronaphthalene-1,2-diol; |
| Formule moléculaire | C11H12O2 |
| Poids Moléculaire | 176.2118 |
| InChl | InChI=1/C11H12O2/c1-7-2-3-8-4-5-10(12)11(13)9(8)6-7/h2-6,10-13H,1H3/t10-,11+/m0/s1 |
| Numéro de registre CAS | 127926-10-7 |
| Structure moléculaire | ![]() |
| Densité | 1.26g/cm3 |
| Point d'ébullition | 339.9°C at 760 mmHg |
| Indice de réfraction | 1.644 |
| Point d'éclair | 168.4°C |
| Pression de vapeur | 3.45E-05mmHg at 25°C |
| MSDS | |