ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13140-56-2 1-(2,4-dimethylphenyl)-3-phenylthiourea |
|
| Nom | 1-(2,4-dimethylphenyl)-3-phenylthiourea |
| Nom anglais | 1-(2,4-dimethylphenyl)-3-phenylthiourea;thiourea, N-(2,4-dimethylphenyl)-N'-phenyl- |
| Formule moléculaire | C15H16N2S |
| Poids Moléculaire | 256.3659 |
| InChl | InChI=1/C15H16N2S/c1-11-8-9-14(12(2)10-11)17-15(18)16-13-6-4-3-5-7-13/h3-10H,1-2H3,(H2,16,17,18) |
| Numéro de registre CAS | 13140-56-2 |
| Structure moléculaire | ![]() |
| Densité | 1.219g/cm3 |
| Point d'ébullition | 372°C at 760 mmHg |
| Indice de réfraction | 1.707 |
| Point d'éclair | 178.8°C |
| Pression de vapeur | 9.91E-06mmHg at 25°C |
| MSDS | |