ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
16048-31-0 1-(4-hexylphenyl)-N-methylpropan-2-amine |
|
| Nom | 1-(4-hexylphenyl)-N-methylpropan-2-amine |
| Nom anglais | 1-(4-hexylphenyl)-N-methylpropan-2-amine; |
| Formule moléculaire | C16H27N |
| Poids Moléculaire | 233.3923 |
| InChl | InChI=1/C16H27N/c1-4-5-6-7-8-15-9-11-16(12-10-15)13-14(2)17-3/h9-12,14,17H,4-8,13H2,1-3H3 |
| Numéro de registre CAS | 16048-31-0 |
| Structure moléculaire | ![]() |
| Densité | 0.886g/cm3 |
| Point d'ébullition | 325.5°C at 760 mmHg |
| Indice de réfraction | 1.494 |
| Point d'éclair | 132.3°C |
| Pression de vapeur | 0.00023mmHg at 25°C |
| MSDS | |