ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
16275-53-9 1-(2-methylpropyl)-3-phenylthiourea |
|
| Nom | 1-(2-methylpropyl)-3-phenylthiourea |
| Nom anglais | 1-(2-methylpropyl)-3-phenylthiourea;1-Isobutyl-3-phenylthiourea;Thiourea, N-(2-methylpropyl)-N'-phenyl- |
| Formule moléculaire | C11H16N2S |
| Poids Moléculaire | 208.3231 |
| InChl | InChI=1/C11H16N2S/c1-9(2)8-12-11(14)13-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H2,12,13,14) |
| Numéro de registre CAS | 16275-53-9 |
| Structure moléculaire | ![]() |
| Densité | 1.101g/cm3 |
| Point d'ébullition | 292.9°C at 760 mmHg |
| Indice de réfraction | 1.606 |
| Point d'éclair | 131°C |
| Pression de vapeur | 0.00178mmHg at 25°C |
| MSDS | |