ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
18220-81-0 1-(2,4-dinitrophenyl)-2-(tricyclo[3.3.1.1~3,7~]dec-1-ylmethylidene)hydrazine |
|
| Nom | 1-(2,4-dinitrophenyl)-2-(tricyclo[3.3.1.1~3,7~]dec-1-ylmethylidene)hydrazine |
| Nom anglais | 1-(2,4-dinitrophenyl)-2-(tricyclo[3.3.1.1~3,7~]dec-1-ylmethylidene)hydrazine; |
| Formule moléculaire | C17H20N4O4 |
| Poids Moléculaire | 344.3651 |
| InChl | InChI=1/C17H20N4O4/c22-20(23)14-1-2-15(16(6-14)21(24)25)19-18-10-17-7-11-3-12(8-17)5-13(4-11)9-17/h1-2,6,10-13,19H,3-5,7-9H2 |
| Numéro de registre CAS | 18220-81-0 |
| Structure moléculaire | ![]() |
| Densité | 1.58g/cm3 |
| Point d'ébullition | 505°C at 760 mmHg |
| Indice de réfraction | 1.749 |
| Point d'éclair | 259.2°C |
| Pression de vapeur | 2.53E-10mmHg at 25°C |
| MSDS | |