ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
18300-67-9 4-(diéthylamino)benzaldéhyde thiosemicarbazone |
|
| Nom | 4-(diéthylamino)benzaldéhyde thiosemicarbazone |
| Synonymes | ;(2E)-2-[4-(Diéthylamino)benzylidène]hydrazinecarbothioamide ; |
| Nom anglais | 4-(diethylamino)benzaldehyde thiosemicarbazone;(2E)-2-[4-(Diethylamino)benzylidene]hydrazinecarbothioamide |
| Formule moléculaire | C12H18N4S |
| Poids Moléculaire | 250.3631 |
| InChl | InChI=1/C12H18N4S/c1-3-16(4-2)11-7-5-10(6-8-11)9-14-15-12(13)17/h5-9H,3-4H2,1-2H3,(H3,13,15,17)/b14-9+ |
| Numéro de registre CAS | 18300-67-9 |
| Structure moléculaire | ![]() |
| Densité | 1.132g/cm3 |
| Point d'ébullition | 401.909°C at 760 mmHg |
| Indice de réfraction | 1.586 |
| Point d'éclair | 196.868°C |
| Pression de vapeur | 0mmHg at 25°C |
| MSDS | |