ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
185-13-7 2-selenaspiro[3.5]nonane |
|
| Nom | 2-selenaspiro[3.5]nonane |
| Nom anglais | 2-selenaspiro[3.5]nonane;2-Selenaspiro[3.5]nonane |
| Formule moléculaire | C8H14Se |
| Poids Moléculaire | 189.1568 |
| InChl | InChI=1/C8H14Se/c1-2-4-8(5-3-1)6-9-7-8/h1-7H2 |
| Numéro de registre CAS | 185-13-7 |
| Structure moléculaire | ![]() |
| Point d'ébullition | 236°C at 760 mmHg |
| Point d'éclair | 96.6°C |
| Pression de vapeur | 0.0742mmHg at 25°C |
| MSDS | |