ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
205-97-0 naphto[2,3-e]acéphénanthrylène |
|
| Nom | naphto[2,3-e]acéphénanthrylène |
| Synonymes | ; naphte[2,3-e]acéphénanthrylène ; |
| Nom anglais | naphtho[2,3-e]acephenanthrylene;naphth[2,3-e]acephenanthrylene |
| Formule moléculaire | C24H14 |
| Poids Moléculaire | 302.368 |
| InChl | InChI=1/C24H14/c1-2-7-16-13-22-21(12-15(16)6-1)20-11-5-10-19-18-9-4-3-8-17(18)14-23(22)24(19)20/h1-14H |
| Numéro de registre CAS | 205-97-0;60382-88-9 |
| Structure moléculaire | ![]() |
| Densité | 1.313g/cm3 |
| Point d'ébullition | 552.3°C at 760 mmHg |
| Indice de réfraction | 1.912 |
| Point d'éclair | 282°C |
| Pression de vapeur | 1.12E-11mmHg at 25°C |
| MSDS | |