ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25067-02-1 2-éthylhexyl prop-2-énoate - acétate d’éthényle (1:1) |
|
| Nom | 2-éthylhexyl prop-2-énoate - acétate d’éthényle (1:1) |
| Nom anglais | 2-ethylhexyl prop-2-enoate - ethenyl acetate (1:1); |
| Formule moléculaire | C15H26O4 |
| Poids Moléculaire | 270.3645 |
| InChl | InChI=1/C11H20O2.C4H6O2/c1-4-7-8-10(5-2)9-13-11(12)6-3;1-3-6-4(2)5/h6,10H,3-5,7-9H2,1-2H3;3H,1H2,2H3 |
| Numéro de registre CAS | 25067-02-1;41259-31-8;9060-83-7 |
| Structure moléculaire | ![]() |
| Point d'ébullition | 216°C at 760 mmHg |
| Point d'éclair | 79.4°C |
| Pression de vapeur | 0.143mmHg at 25°C |
| MSDS | |