ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25896-97-3 octahydro-4,7-méthano-1H-indenedicarbaldéhyde |
|
| Nom | octahydro-4,7-méthano-1H-indenedicarbaldéhyde |
| Synonymes | Octahydro-4,7-méthano-1H-indenedicarbaldéhyde ; octahydro-1H-4,7-méthanoindène-1,1-dicarbaldéhyde ; |
| Nom anglais | octahydro-4,7-methano-1H-indenedicarbaldehyde;Octahydro-4,7-methano-1H-indenedicarbaldehyde;octahydro-1H-4,7-methanoindene-1,1-dicarbaldehyde |
| Formule moléculaire | C12H16O2 |
| Poids Moléculaire | 192.2542 |
| InChl | InChI=1/C12H16O2/c13-6-12(7-14)4-3-10-8-1-2-9(5-8)11(10)12/h6-11H,1-5H2 |
| Numéro de registre CAS | 25896-97-3 |
| EINECS | 247-319-3 |
| Structure moléculaire | ![]() |
| Densité | 1.272g/cm3 |
| Point d'ébullition | 298.7°C at 760 mmHg |
| Indice de réfraction | 1.653 |
| Point d'éclair | 111.5°C |
| Pression de vapeur | 0.00125mmHg at 25°C |
| MSDS | |