ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
293733-89-8 2-[(3,4,5-triméthyl-2H-pyrrol-2-ylidène)méthyl]-, bromhydrate (1:1) |
|
| Nom | 2-[(3,4,5-triméthyl-2H-pyrrol-2-ylidène)méthyl]-, bromhydrate (1:1) |
| Nom anglais | 1H-pyrrole, 2-[(3,4,5-trimethyl-2H-pyrrol-2-ylidene)methyl]-, hydrobromide (1:1); |
| Formule moléculaire | C12H15BrN2 |
| Poids Moléculaire | 267.1649 |
| InChl | InChI=1/C12H14N2.BrH/c1-8-9(2)12(14-10(8)3)7-11-5-4-6-13-11;/h4-7,13H,1-3H3;1H |
| Numéro de registre CAS | 293733-89-8 |
| Structure moléculaire | ![]() |
| MSDS | |