ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
30760-48-6 3-méthyl-2-(méthylsulfanyl)-4,5-dihydro-1,3-thiazol-3-ium |
|
| Nom | 3-méthyl-2-(méthylsulfanyl)-4,5-dihydro-1,3-thiazol-3-ium |
| Nom anglais | 3-methyl-2-(methylsulfanyl)-4,5-dihydro-1,3-thiazol-3-ium; |
| Formule moléculaire | C5H10NS2 |
| Poids Moléculaire | 148.2691 |
| InChl | InChI=1/C5H10NS2/c1-6-3-4-8-5(6)7-2/h3-4H2,1-2H3/q+1 |
| Numéro de registre CAS | 30760-48-6 |
| Structure moléculaire | ![]() |
| MSDS | |