ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
30877-81-7 1-(3-amino-4-piperidin-1-ylphenyl)ethanone |
|
| Nom | 1-(3-amino-4-piperidin-1-ylphenyl)ethanone |
| Nom anglais | 1-(3-amino-4-piperidin-1-ylphenyl)ethanone;1-(3-amino-4-piperidinophenyl)ethan-1-one |
| Formule moléculaire | C13H18N2O |
| Poids Moléculaire | 218.2948 |
| InChl | InChI=1/C13H18N2O/c1-10(16)11-5-6-13(12(14)9-11)15-7-3-2-4-8-15/h5-6,9H,2-4,7-8,14H2,1H3 |
| Numéro de registre CAS | 30877-81-7 |
| Structure moléculaire | ![]() |
| Densité | 1.116g/cm3 |
| Point d'ébullition | 425.5°C at 760 mmHg |
| Indice de réfraction | 1.582 |
| Point d'éclair | 211.1°C |
| Pression de vapeur | 1.9E-07mmHg at 25°C |
| MSDS | |