ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
37630-47-0 1,5-bis(4-chlorophényl)penta-1,4-diène-3-one |
|
| Nom | 1,5-bis(4-chlorophényl)penta-1,4-diène-3-one |
| Synonymes | ; |
| Nom anglais | 1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one; |
| Formule moléculaire | C17H12Cl2O |
| Poids Moléculaire | 303.1826 |
| InChl | InChI=1/C17H12Cl2O/c18-15-7-1-13(2-8-15)5-11-17(20)12-6-14-3-9-16(19)10-4-14/h1-12H |
| Numéro de registre CAS | 37630-47-0 |
| Structure moléculaire | ![]() |
| Densité | 1.28g/cm3 |
| Point d'ébullition | 464.9°C at 760 mmHg |
| Indice de réfraction | 1.66 |
| Point d'éclair | 195.5°C |
| Pression de vapeur | 8.04E-09mmHg at 25°C |
| MSDS | |