ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4379-22-0 (2-phényl-2-propyl-1,3-dioxolan-4-yl)méthanol |
|
| Nom | (2-phényl-2-propyl-1,3-dioxolan-4-yl)méthanol |
| Synonymes | ;(2-phényl-2-propyl-1,3-dioxolan-4-yl)méthanol ; 1,3-dioxolane-4-méthanol, 2-phényl-2-propyle ; |
| Nom anglais | (2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol;(2-Phenyl-2-propyl-1,3-dioxolan-4-yl)methanol;1,3-dioxolane-4-methanol, 2-phenyl-2-propyl- |
| Formule moléculaire | C13H18O3 |
| Poids Moléculaire | 222.2802 |
| InChl | InChI=1/C13H18O3/c1-2-8-13(11-6-4-3-5-7-11)15-10-12(9-14)16-13/h3-7,12,14H,2,8-10H2,1H3 |
| Numéro de registre CAS | 4379-22-0 |
| Structure moléculaire | ![]() |
| Densité | 1.078g/cm3 |
| Point d'ébullition | 337.6°C at 760 mmHg |
| Indice de réfraction | 1.509 |
| Point d'éclair | 167.3°C |
| Pression de vapeur | 4.05E-05mmHg at 25°C |
| MSDS | |