ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51864-09-6 (2E)-2-[1-(hydroxyamino)éthylidène]naphtalène-1(2H)-one |
|
| Nom | (2E)-2-[1-(hydroxyamino)éthylidène]naphtalène-1(2H)-one |
| Synonymes | ; |
| Nom anglais | (2E)-2-[1-(hydroxyamino)ethylidene]naphthalen-1(2H)-one; |
| Formule moléculaire | C12H11NO2 |
| Poids Moléculaire | 201.2212 |
| InChl | InChI=1/C12H11NO2/c1-8(13-15)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,13,15H,1H3/b10-8+ |
| Numéro de registre CAS | 51864-09-6 |
| Structure moléculaire | ![]() |
| Densité | 1.275g/cm3 |
| Point d'ébullition | 380.3°C at 760 mmHg |
| Indice de réfraction | 1.638 |
| Point d'éclair | 183.8°C |
| Pression de vapeur | 1.85E-06mmHg at 25°C |
| MSDS | |