ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56348-79-9 4-chloro-2,8-difluorophénoxathine |
|
| Nom | 4-chloro-2,8-difluorophénoxathine |
| Nom anglais | 4-chloro-2,8-difluorophenoxathiine; |
| Formule moléculaire | C12H5ClF2OS |
| Poids Moléculaire | 270.6823 |
| InChl | InChI=1/C12H5ClF2OS/c13-8-3-7(15)5-11-12(8)16-9-2-1-6(14)4-10(9)17-11/h1-5H |
| Numéro de registre CAS | 56348-79-9 |
| Structure moléculaire | ![]() |
| Densité | 1.529g/cm3 |
| Point d'ébullition | 336.7°C at 760 mmHg |
| Indice de réfraction | 1.64 |
| Point d'éclair | 157.4°C |
| Pression de vapeur | 0.000215mmHg at 25°C |
| MSDS | |