ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 619-01-2 dihydrocarvéol, mélange d’isomères | |
| Nom | dihydrocarvéol, mélange d’isomères | 
| Synonymes | ;D ihydrocarvéol, mélange d’isomères ; | 
| Nom anglais | dihydrocarveol, mixture of isomers;Dihydrocarveol,mixture of isomers | 
| Formule moléculaire | C10H18O | 
| Poids Moléculaire | 154.2493 | 
| InChl | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-11H,1,4-6H2,2-3H3 | 
| Numéro de registre CAS | 619-01-2 | 
| EINECS | 210-575-1 | 
| Structure moléculaire |  | 
| Point d'ébullition | 224℃ | 
| MSDS | |