ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6308-18-5 cyclohexane-1,4-diyldiméthanediacétate ediyle |
|
| Nom | cyclohexane-1,4-diyldiméthanediacétate ediyle |
| Nom anglais | cyclohexane-1,4-diyldimethanediyl diacetate; |
| Formule moléculaire | C12H20O4 |
| Poids Moléculaire | 228.2848 |
| InChl | InChI=1/C12H20O4/c1-9(13)15-7-11-3-5-12(6-4-11)8-16-10(2)14/h11-12H,3-8H2,1-2H3 |
| Numéro de registre CAS | 6308-18-5 |
| Structure moléculaire | ![]() |
| Densité | 1.03g/cm3 |
| Point d'ébullition | 284.2°C at 760 mmHg |
| Indice de réfraction | 1.446 |
| Point d'éclair | 131.5°C |
| Pression de vapeur | 0.00302mmHg at 25°C |
| MSDS | |