ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7143-04-6 2-(2-heptadecyl-1H-imidazol-1-yl)ethanol |
|
| Nom | 2-(2-heptadecyl-1H-imidazol-1-yl)ethanol |
| Nom anglais | 2-(2-heptadecyl-1H-imidazol-1-yl)ethanol;Ethanol, 2-(2-heptadecylimidazol-1-yl)-;Imidazole-1-ethanol, 2-heptadecyl- |
| Formule moléculaire | C22H42N2O |
| Poids Moléculaire | 350.5817 |
| InChl | InChI=1/C22H42N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-23-18-19-24(22)20-21-25/h18-19,25H,2-17,20-21H2,1H3 |
| Numéro de registre CAS | 7143-04-6 |
| Structure moléculaire | ![]() |
| Densité | 0.94g/cm3 |
| Point d'ébullition | 495.1°C at 760 mmHg |
| Indice de réfraction | 1.501 |
| Point d'éclair | 253.2°C |
| Pression de vapeur | 1.27E-10mmHg at 25°C |
| MSDS | |