ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
|
| Nom | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
| Nom anglais | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
| Formule moléculaire | C14H8Cl4 |
| Poids Moléculaire | 318.02 |
| InChl | InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
| Numéro de registre CAS | 72-55-9 |
| EINECS | 200-784-6 |
| Structure moléculaire | ![]() |
| Point de fusion | 87-90℃ |
| solubilité dans l'eau | 0.00000013 g/100 mL |
| Les symboles de danger | |
| Codes des risques | R22##Harmful if swallowed.||R33##Danger of cummulative effects.:; |
| Description de sécurité | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |