ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7228-54-8 manganèse(2 ) 2,2'-{cyclohexane-1,2-diylbis[nitrilo(E)méthylylidène]}bispipéridine-1-IDE - acide perchlorique (1:2) |
|
| Nom | manganèse(2 ) 2,2'-{cyclohexane-1,2-diylbis[nitrilo(E)méthylylidène]}bispipéridine-1-IDE - acide perchlorique (1:2) |
| Synonymes | ; |
| Nom anglais | manganese(2+) 2,2'-{cyclohexane-1,2-diylbis[nitrilo(E)methylylidene]}bispiperidin-1-ide - perchloric acid (1:2); |
| Formule moléculaire | C18H32Cl2MnN4O8 |
| Poids Moléculaire | 558.3127 |
| InChl | InChI=1/C18H30N4.2ClHO4.Mn/c1-2-10-18(22-14-16-8-4-6-12-20-16)17(9-1)21-13-15-7-3-5-11-19-15;2*2-1(3,4)5;/h13-18H,1-12H2;2*(H,2,3,4,5);/q-2;;;+2/b21-13+,22-14+;;; |
| Numéro de registre CAS | 7228-54-8 |
| Structure moléculaire | ![]() |
| Point d'ébullition | 489°C at 760 mmHg |
| Point d'éclair | 249.5°C |
| Pression de vapeur | 1.04E-09mmHg at 25°C |
| MSDS | |