ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
74054-85-6 1,2-dichloroéthanol |
|
| Nom | 1,2-dichloroéthanol |
| Synonymes | 1,2-dichloroéthanol ; |
| Nom anglais | 1,2-dichloroethanol;Ethanol, 1,2-dichloro- |
| Formule moléculaire | C2H4Cl2O |
| Poids Moléculaire | 114.9586 |
| InChl | InChI=1/C2H4Cl2O/c3-1-2(4)5/h2,5H,1H2 |
| Numéro de registre CAS | 74054-85-6 |
| Structure moléculaire | ![]() |
| Densité | 1.398g/cm3 |
| Point d'ébullition | 166.5°C at 760 mmHg |
| Indice de réfraction | 1.459 |
| Point d'éclair | 85.8°C |
| Pression de vapeur | 0.59mmHg at 25°C |
| MSDS | |