ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
76500-09-9 N~2~-(3,4-dihydroxyphényl)-N~2~-méthyl-L-glutamine |
|
| Nom | N~2~-(3,4-dihydroxyphényl)-N~2~-méthyl-L-glutamine |
| Synonymes | ; |
| Nom anglais | N~2~-(3,4-dihydroxyphenyl)-N~2~-methyl-L-glutamine; |
| Formule moléculaire | C12H16N2O5 |
| Poids Moléculaire | 268.2658 |
| InChl | InChI=1/C12H16N2O5/c1-14(7-2-4-9(15)10(16)6-7)8(12(18)19)3-5-11(13)17/h2,4,6,8,15-16H,3,5H2,1H3,(H2,13,17)(H,18,19)/t8-/m0/s1 |
| Numéro de registre CAS | 76500-09-9 |
| Structure moléculaire | ![]() |
| Densité | 1.441g/cm3 |
| Point d'ébullition | 664°C at 760 mmHg |
| Indice de réfraction | 1.65 |
| Point d'éclair | 355.4°C |
| Pression de vapeur | 1.55E-18mmHg at 25°C |
| MSDS | |