ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7651-86-7 phénanthrène-4-ol |
|
| Nom | phénanthrène-4-ol |
| Synonymes | 4-hydroxyphénanthrène ; 4-Phénanthrénol ; NSC 171284 ; Phénanthrène-4-ol |
| Nom anglais | phenanthren-4-ol;4-Hydroxyphenanthrene;4-Phenanthrenol;NSC 171284;Phenanthren-4-ol |
| Formule moléculaire | C14H10O |
| Poids Moléculaire | 194.2286 |
| InChl | InChI=1/C14H10O/c15-13-7-3-5-11-9-8-10-4-1-2-6-12(10)14(11)13/h1-9,15H |
| Numéro de registre CAS | 7651-86-7 |
| EINECS | 231-613-3 |
| Structure moléculaire | ![]() |
| Densité | 1.244g/cm3 |
| Point d'ébullition | 404.5°C at 760 mmHg |
| Indice de réfraction | 1.753 |
| Point d'éclair | 197.7°C |
| Pression de vapeur | 4.02E-07mmHg at 25°C |
| MSDS | |