ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
874-89-5 4-Cyanobenzyl alcohol |
|
| Nom | 4-Cyanobenzyl alcohol |
| Nom anglais | 4-Cyanobenzyl alcohol;4-(Hydroxymethyl)benzonitrile;benzonitrile, 4-(hydroxymethyl)- |
| Formule moléculaire | C8H7NO |
| Poids Moléculaire | 133.1473 |
| InChl | InChI=1/C8H7NO/c9-5-7-1-3-8(6-10)4-2-7/h1-4,10H,6H2 |
| Numéro de registre CAS | 874-89-5 |
| Structure moléculaire | ![]() |
| Densité | 1.16g/cm3 |
| Point d'ébullition | 297.4°C at 760 mmHg |
| Indice de réfraction | 1.572 |
| Point d'éclair | 133.6°C |
| Pression de vapeur | 0.00061mmHg at 25°C |
| MSDS | |