ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
93762-15-3 acide 2-acétyl-4-hydroxy-3-méthoxybenzoïque |
|
| Nom | acide 2-acétyl-4-hydroxy-3-méthoxybenzoïque |
| Synonymes | Acide 2-acétyl-4-hydroxy-3-méthoxybenzoïque |
| Nom anglais | 2-acetyl-4-hydroxy-3-methoxybenzoic acid;2-Acetyl-4-hydroxy-3-methoxybenzoic acid |
| Formule moléculaire | C10H10O5 |
| Poids Moléculaire | 210.1834 |
| InChl | InChI=1/C10H10O5/c1-5(11)8-6(10(13)14)3-4-7(12)9(8)15-2/h3-4,12H,1-2H3,(H,13,14) |
| Numéro de registre CAS | 93762-15-3 |
| EINECS | 297-729-1 |
| Structure moléculaire | ![]() |
| Densité | 1.347g/cm3 |
| Point d'ébullition | 425.6°C at 760 mmHg |
| Indice de réfraction | 1.578 |
| Point d'éclair | 172.6°C |
| Pression de vapeur | 5.29E-08mmHg at 25°C |
| MSDS | |