ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99845-55-3 4-amino-2-(5-nitrofuran-2-yl)benzohydrazide |
|
| Nom | 4-amino-2-(5-nitrofuran-2-yl)benzohydrazide |
| Synonymes | ; |
| Nom anglais | 4-amino-2-(5-nitrofuran-2-yl)benzohydrazide; |
| Formule moléculaire | C11H10N4O4 |
| Poids Moléculaire | 262.2215 |
| InChl | InChI=1/C11H10N4O4/c12-6-1-2-7(11(16)14-13)8(5-6)9-3-4-10(19-9)15(17)18/h1-5H,12-13H2,(H,14,16) |
| Numéro de registre CAS | 99845-55-3 |
| Structure moléculaire | ![]() |
| Densité | 1.463g/cm3 |
| Indice de réfraction | 1.663 |
| MSDS | |