ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1444-65-1 2-Phenylcyclohexanone |
|
Ονομασία του προϊόντος | 2-Phenylcyclohexanone |
Αγγλικό όνομα | 2-Phenylcyclohexanone;AI3-07036;Cyclohexanone, 2-phenyl-;(2S)-2-phenylcyclohexanone;(2R)-2-phenylcyclohexanone |
MF | C12H14O |
Μοριακό βάρος | 174.239 |
InChI | InChI=1/C12H14O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2/t11-/m1/s1 |
CAS ΟΧΙ | 1444-65-1 |
EINECS | 215-888-7 |
Μοριακή δομή | ![]() |
Πυκνότητα | 1.042g/cm3 |
Σημείο τήξης | 56-59℃ |
Σημείο βρασμού | 294°C at 760 mmHg |
Δείκτης διάθλασης | 1.537 |
Σημείο ανάφλεξης | 123.7°C |
Πίεση ατμών | 0.00167mmHg at 25°C |
Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
MSDS |