ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22560-21-0 Potassium triethylborohydride |
|
| Ονομασία του προϊόντος | Potassium triethylborohydride |
| Αγγλικό όνομα | Potassium triethylborohydride;potassium triethylhydroborate;potassium triethyl(hydrido)borate(1-);Potassium hydrotriethylborate |
| MF | C6H16BK |
| Μοριακό βάρος | 138.1005 |
| InChI | InChI=1/C6H16B.K/c1-4-7(5-2)6-3;/h7H,4-6H2,1-3H3;/q-1;+1 |
| CAS ΟΧΙ | 22560-21-0 |
| EINECS | 245-077-3 |
| Μοριακή δομή | ![]() |
| Σύμβολα επικινδυνότητας | |
| Κινδύνου Κώδικες | R11##Highly flammable.||R15##Contact with water liberates highly flammable gases.||R19##May form explosive peroxides.||R34##Causes burns.:; |
| Περιγραφή της ασφάλειας | S16##Keep away from sources of ignition - No smoking.||S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S7/8##Keep container tightly closed and dry.:; |
| MSDS | |