Chemindex > 22560-21-0
GR ▼
22560-21-0 Potassium triethylborohydride |
|
| Ονομασία του προϊόντος | Potassium triethylborohydride |
| Αγγλικό όνομα | Potassium triethylborohydride;potassium triethylhydroborate;potassium triethyl(hydrido)borate(1-);Potassium hydrotriethylborate |
| MF | C6H16BK |
| Μοριακό βάρος | 138.1005 |
| InChI | InChI=1/C6H16B.K/c1-4-7(5-2)6-3;/h7H,4-6H2,1-3H3;/q-1;+1 |
| CAS ΟΧΙ | 22560-21-0 |
| EINECS | 245-077-3 |
| Μοριακή δομή |  |
| Σύμβολα επικινδυνότητας |  F##Highly flammable||C##Corrosive:; |
| Κινδύνου Κώδικες | R11##Highly flammable.||R15##Contact with water liberates highly flammable gases.||R19##May form explosive peroxides.||R34##Causes burns.:; |
| Περιγραφή της ασφάλειας | S16##Keep away from sources of ignition - No smoking.||S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S7/8##Keep container tightly closed and dry.:; |
| MSDS | |
- Αν σκοπεύετε να προμηθευτείτε χημικές ουσίες από την Κίνα, απλά πηγαίνετε στο εμπορικό κέντρο ChemNet, θα πάρουμε την τελευταία και ανταγωνιστική τιμή από τους κατασκευαστές της Κίνας για εσάς.Παρακαλώ επισκεφθείτε
ChemNet Mall
Η υπηρεσία βάσεων δεδομένων Chemical CAS παρέχεται από ChemIndex.com 