ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2390-54-7 2-[4-(dimethylamino)phenyl]-3,6-dimethylbenzothiazolium chloride |
|
| Ονομασία του προϊόντος | 2-[4-(dimethylamino)phenyl]-3,6-dimethylbenzothiazolium chloride |
| Αγγλικό όνομα | 2-[4-(dimethylamino)phenyl]-3,6-dimethylbenzothiazolium chloride;C.I. 49005;C.I. Basic Yellow 1;Thioflavin T;Thioflavine T;2-[4-(dimethylamino)phenyl]-3,6-dimethyl-1,3-benzothiazol-3-ium chloride |
| MF | C17H19ClN2S |
| Μοριακό βάρος | 318.8642 |
| InChI | InChI=1/C17H19N2S.ClH/c1-12-5-10-15-16(11-12)20-17(19(15)4)13-6-8-14(9-7-13)18(2)3;/h5-11H,1-4H3;1H/q+1;/p-1 |
| CAS ΟΧΙ | 2390-54-7 |
| EINECS | 219-228-9 |
| Μοριακή δομή | ![]() |
| MSDS | |