ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
31118-87-3 1-(2,4,6-Trichlorophenyl)-2-thiourea |
|
| Ονομασία του προϊόντος | 1-(2,4,6-Trichlorophenyl)-2-thiourea |
| Αγγλικό όνομα | 1-(2,4,6-Trichlorophenyl)-2-thiourea;1-(2,4,6-trichlorophenyl)thiourea |
| MF | C7H5Cl3N2S |
| Μοριακό βάρος | 255.552 |
| InChI | InChI=1/C7H5Cl3N2S/c8-3-1-4(9)6(5(10)2-3)12-7(11)13/h1-2H,(H3,11,12,13) |
| CAS ΟΧΙ | 31118-87-3 |
| Μοριακή δομή | ![]() |
| Πυκνότητα | 1.665g/cm3 |
| Σημείο βρασμού | 342.7°C at 760 mmHg |
| Δείκτης διάθλασης | 1.732 |
| Σημείο ανάφλεξης | 161.1°C |
| Πίεση ατμών | 7.37E-05mmHg at 25°C |
| MSDS | |