ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
43111-31-5 2-Chlorophenoxyacetonitrile |
|
| Ονομασία του προϊόντος | 2-Chlorophenoxyacetonitrile |
| Αγγλικό όνομα | 2-Chlorophenoxyacetonitrile; |
| MF | C8H6ClNO |
| Μοριακό βάρος | 167.5923 |
| InChI | InChI=1/C8H6ClNO/c9-7-3-1-2-4-8(7)11-6-5-10/h1-4H,6H2 |
| CAS ΟΧΙ | 43111-31-5 |
| Μοριακή δομή | ![]() |
| Πυκνότητα | 1.238g/cm3 |
| Σημείο βρασμού | 276.7°C at 760 mmHg |
| Δείκτης διάθλασης | 1.538 |
| Σημείο ανάφλεξης | 121.2°C |
| Πίεση ατμών | 0.00472mmHg at 25°C |
| Σύμβολα επικινδυνότητας | |
| Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Περιγραφή της ασφάλειας | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |