ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
43111-31-5 2-Chlorophenoxyacetonitrile |
|
Ονομασία του προϊόντος | 2-Chlorophenoxyacetonitrile |
Αγγλικό όνομα | 2-Chlorophenoxyacetonitrile; |
MF | C8H6ClNO |
Μοριακό βάρος | 167.5923 |
InChI | InChI=1/C8H6ClNO/c9-7-3-1-2-4-8(7)11-6-5-10/h1-4H,6H2 |
CAS ΟΧΙ | 43111-31-5 |
Μοριακή δομή | ![]() |
Πυκνότητα | 1.238g/cm3 |
Σημείο βρασμού | 276.7°C at 760 mmHg |
Δείκτης διάθλασης | 1.538 |
Σημείο ανάφλεξης | 121.2°C |
Πίεση ατμών | 0.00472mmHg at 25°C |
Σύμβολα επικινδυνότητας | |
Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Περιγραφή της ασφάλειας | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |